C22H19NO2 — CID 102272883
(2S,3R)-3-(2-methylphenyl)-N,N-diphenyloxirane-2-carboxamide (PubChem CID 102272883) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is (2S,3R)-3-(2-methylphenyl)-N,N-diphenyloxirane-2-carboxamide.
| Compound Name | (2S,3R)-3-(2-methylphenyl)-N,N-diphenyloxirane-2-carboxamide |
|---|---|
| PubChem CID | 102272883 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | (2S,3R)-3-(2-methylphenyl)-N,N-diphenyloxirane-2-carboxamide |
| SMILES | Cc1ccccc1[C@H]1O[C@@H]1C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO2/c1-16-10-8-9-15-19(16)20-21(25-20)22(24)23(17-11-4-2-5-12-17)18-13-6-3-7-14-18/h2-15,20-21H,1H3/t20-,21+/m1/s1 |
| InChIKey | BEJGZLYLTIIGIN-RTWAWAEBSA-N |
| XLogP | 4.80 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|