C22H22N2O2 — CID 11142538
1-[(1R,2R,11S,12S)-13-acetyl-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaen-9-yl]ethanone (PubChem CID 11142538) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 1-[(1R,2R,11S,12S)-13-acetyl-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaen-9-yl]ethanone.
| Compound Name | 1-[(1R,2R,11S,12S)-13-acetyl-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaen-9-yl]ethanone |
|---|---|
| PubChem CID | 11142538 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 1-[(1R,2R,11S,12S)-13-acetyl-9,13-diazapentacyclo[10.7.1.02,11.03,8.014,19]icosa-3,5,7,14,16,18-hexaen-9-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2[C@H](c3ccccc31)[C@H]1C[C@@H]2N(C(C)=O)c2ccccc21 |
| InChI | InChI=1S/C22H22N2O2/c1-13(25)23-12-18-21-11-17(22(18)16-8-4-5-9-19(16)23)15-7-3-6-10-20(15)24(21)14(2)26/h3-10,17-18,21-22H,11-12H2,1-2H3/t17-,18-,21-,22+/m0/s1 |
| InChIKey | IBTFBPYHXBAFLH-YHDSQAASSA-N |
| XLogP | 3.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |