C13H18N2 — CID 146675583
5-ethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 146675583) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 5-ethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | 5-ethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 146675583 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 5-ethyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CCN1c2ccccc2C2CNCCC21 |
| InChI | InChI=1S/C13H18N2/c1-2-15-12-6-4-3-5-10(12)11-9-14-8-7-13(11)15/h3-6,11,13-14H,2,7-9H2,1H3 |
| InChIKey | GZYIJZZKJIPDMP-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |