C21H24Cl2N2S — CID 10158295
8-(2,4-dichlorophenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 10158295) has the molecular formula C21H24Cl2N2S and a molecular weight of 407.41 g/mol. Its IUPAC name is 8-(2,4-dichlorophenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | 8-(2,4-dichlorophenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 10158295 |
| Molecular Formula | C21H24Cl2N2S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 8-(2,4-dichlorophenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CCSc1cc(-c2ccc(Cl)cc2Cl)cc2c1N(CC)C1CCNCC21 |
| InChI | InChI=1S/C21H24Cl2N2S/c1-3-25-19-7-8-24-12-17(19)16-9-13(10-20(21(16)25)26-4-2)15-6-5-14(22)11-18(15)23/h5-6,9-11,17,19,24H,3-4,7-8,12H2,1-2H3 |
| InChIKey | BKUCPVOMSOXIQM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |