C21H20ClF3N2S — CID 69514466
(11S,16R)-3-[4-chloro-2-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene (PubChem CID 69514466) has the molecular formula C21H20ClF3N2S and a molecular weight of 424.90 g/mol. Its IUPAC name is (11S,16R)-3-[4-chloro-2-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene.
| Compound Name | (11S,16R)-3-[4-chloro-2-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
|---|---|
| PubChem CID | 69514466 |
| Molecular Formula | C21H20ClF3N2S |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (11S,16R)-3-[4-chloro-2-(trifluoromethyl)phenyl]-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene |
| SMILES | C1CN2[C@H]3CCNC[C@H]3C4=C2C(=CC(=C4)C5=C(C=C(C=C5)Cl)C(F)(F)F)SC1 |
| InChI | InChI=1S/C21H20ClF3N2S/c22-13-2-3-14(17(10-13)21(23,24)25)12-8-15-16-11-26-5-4-18(16)27-6-1-7-28-19(9-12)20(15)27/h2-3,8-10,16,18,26H,1,4-7,11H2/t16-,18-/m0/s1 |
| InChIKey | MJUGABGAFCYBGE-WMZOPIPTSA-N |
| XLogP | 5.40 |
| TPSA | 40.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | 576 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |