C18H18ClFN2S — CID 68818584
(4aR,9bR)-6-(3-chloro-4-fluorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole (PubChem CID 68818584) has the molecular formula C18H18ClFN2S and a molecular weight of 348.87 g/mol. Its IUPAC name is (4aR,9bR)-6-(3-chloro-4-fluorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | (4aR,9bR)-6-(3-chloro-4-fluorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 68818584 |
| Molecular Formula | C18H18ClFN2S |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (4aR,9bR)-6-(3-chloro-4-fluorophenyl)sulfanyl-2-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CN1CC[C@H]2Nc3c(Sc4ccc(F)c(Cl)c4)cccc3[C@@H]2C1 |
| InChI | InChI=1S/C18H18ClFN2S/c1-22-8-7-16-13(10-22)12-3-2-4-17(18(12)21-16)23-11-5-6-15(20)14(19)9-11/h2-6,9,13,16,21H,7-8,10H2,1H3/t13-,16+/m0/s1 |
| InChIKey | SKCQJTFXZOJPCN-XJKSGUPXSA-N |
| XLogP | 4.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |