C22H27ClN2S — CID 142212923
8-(4-chloro-2-methylphenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole (PubChem CID 142212923) has the molecular formula C22H27ClN2S and a molecular weight of 386.99 g/mol. Its IUPAC name is 8-(4-chloro-2-methylphenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole.
| Compound Name | 8-(4-chloro-2-methylphenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
|---|---|
| PubChem CID | 142212923 |
| Molecular Formula | C22H27ClN2S |
| Molecular Weight | 386.99 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 8-(4-chloro-2-methylphenyl)-5-ethyl-6-ethylsulfanyl-1,2,3,4,4a,9b-hexahydropyrido[4,3-b]indole |
| SMILES | CCSc1cc(-c2ccc(Cl)cc2C)cc2c1N(CC)C1CCNCC21 |
| InChI | InChI=1S/C22H27ClN2S/c1-4-25-20-8-9-24-13-19(20)18-11-15(12-21(22(18)25)26-5-2)17-7-6-16(23)10-14(17)3/h6-7,10-12,19-20,24H,4-5,8-9,13H2,1-3H3 |
| InChIKey | PKLQYFFEFKJLMP-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.99 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |