C22H28N2O3S — CID 160915916
(11S,16R)-3-(2,4-dimethylphenyl)-7λ6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7,7-dioxide;hydrate (PubChem CID 160915916) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is (11S,16R)-3-(2,4-dimethylphenyl)-7λ6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7,7-dioxide;hydrate.
| Compound Name | (11S,16R)-3-(2,4-dimethylphenyl)-7λ6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7,7-dioxide;hydrate |
|---|---|
| PubChem CID | 160915916 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | (11S,16R)-3-(2,4-dimethylphenyl)-7λ6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene 7,7-dioxide;hydrate |
| SMILES | Cc1ccc(-c2cc3c4c(c2)[C@@H]2CNCC[C@@H]2N4CCS(=O)(=O)C3)c(C)c1.O |
| InChI | InChI=1S/C22H26N2O2S.H2O/c1-14-3-4-18(15(2)9-14)16-10-17-13-27(25,26)8-7-24-21-5-6-23-12-20(21)19(11-16)22(17)24;/h3-4,9-11,20-21,23H,5-8,12-13H2,1-2H3;1H2/t20-,21-;/m0./s1 |
| InChIKey | HDTFUDDCCWJDQR-GUTACTQSSA-N |
| XLogP | 2.34 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |