C15H20N2 — CID 86593178
(2R,8S)-1,6-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-9,11,13(17)-triene (PubChem CID 86593178) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (2R,8S)-1,6-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-9,11,13(17)-triene.
| Compound Name | (2R,8S)-1,6-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-9,11,13(17)-triene |
|---|---|
| PubChem CID | 86593178 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | (2R,8S)-1,6-diazatetracyclo[7.7.1.02,8.013,17]heptadeca-9,11,13(17)-triene |
| SMILES | c1cc2c3c(c1)[C@H]1CNCCC[C@H]1N3CCC2 |
| InChI | InChI=1S/C15H20N2/c1-4-11-5-3-9-17-14-7-2-8-16-10-13(14)12(6-1)15(11)17/h1,4,6,13-14,16H,2-3,5,7-10H2/t13-,14-/m1/s1 |
| InChIKey | ZHCZPVOZDMRRNL-ZIAGYGMSSA-N |
| XLogP | 2.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |