C15H22Cl2N2 — CID 172765644
(2R,7R)-5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene;dihydrochloride (PubChem CID 172765644) has the molecular formula C15H22Cl2N2 and a molecular weight of 301.26 g/mol. Its IUPAC name is (2R,7R)-5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene;dihydrochloride.
| Compound Name | (2R,7R)-5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene;dihydrochloride |
|---|---|
| PubChem CID | 172765644 |
| Molecular Formula | C15H22Cl2N2 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (2R,7R)-5,9-diazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),13(17),14-triene;dihydrochloride |
| SMILES | Cl.Cl.c1cc2c3c(c1)[C@@H]1CCNC[C@@H]1CN3CCC2 |
| InChI | InChI=1S/C15H20N2.2ClH/c1-3-11-4-2-8-17-10-12-9-16-7-6-13(12)14(5-1)15(11)17;;/h1,3,5,12-13,16H,2,4,6-10H2;2*1H/t12-,13-;;/m1../s1 |
| InChIKey | MGSHCAPVXTXEHG-SNFSYSBXSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |