C17H26N2 — CID 90724531
(12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;ethane (PubChem CID 90724531) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;ethane.
| Compound Name | (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;ethane |
|---|---|
| PubChem CID | 90724531 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-triene;ethane |
| SMILES | CC.c1cc2c3c(c1)[C@H]1CCC[C@H]1CN3CCNC2 |
| InChI | InChI=1S/C15H20N2.C2H6/c1-3-11-9-16-7-8-17-10-12-4-2-5-13(12)14(6-1)15(11)17;1-2/h1,3,6,12-13,16H,2,4-5,7-10H2;1-2H3/t12-,13-;/m0./s1 |
| InChIKey | PXGQIHWZDVFBNG-QNTKWALQSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |