C15H20N2O — CID 58645364
(12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-8-ol (PubChem CID 58645364) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-8-ol.
| Compound Name | (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-8-ol |
|---|---|
| PubChem CID | 58645364 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-8-ol |
| SMILES | OC1CN2C[C@@H]3CCC[C@@H]3c3cccc(c32)CN1 |
| InChI | InChI=1S/C15H20N2O/c18-14-9-17-8-11-4-2-5-12(11)13-6-1-3-10(7-16-14)15(13)17/h1,3,6,11-12,14,16,18H,2,4-5,7-9H2/t11-,12-,14?/m0/s1 |
| InChIKey | NPEZFNQPTHRRCD-VHBIQUBJSA-N |
| XLogP | 1.81 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |