C15H20N2O4S — CID 58645367
[(12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-13-yl] hydrogen sulfate (PubChem CID 58645367) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is [(12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-13-yl] hydrogen sulfate.
| Compound Name | [(12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-13-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 58645367 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | [(12R,16S)-7,10-diazatetracyclo[8.6.1.05,17.012,16]heptadeca-1,3,5(17)-trien-13-yl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OC1CC[C@@H]2c3cccc4c3N(CCNC4)C[C@H]12 |
| InChI | InChI=1S/C15H20N2O4S/c18-22(19,20)21-14-5-4-11-12-3-1-2-10-8-16-6-7-17(15(10)12)9-13(11)14/h1-3,11,13-14,16H,4-9H2,(H,18,19,20)/t11-,13+,14?/m1/s1 |
| InChIKey | WEQYXMUOCROZII-LXKBMQFRSA-N |
| XLogP | 1.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|