C20H20Cl2N2 — CID 23518399
(10S,14S)-7-(2,3-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene (PubChem CID 23518399) has the molecular formula C20H20Cl2N2 and a molecular weight of 359.30 g/mol. Its IUPAC name is (10S,14S)-7-(2,3-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene.
| Compound Name | (10S,14S)-7-(2,3-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene |
|---|---|
| PubChem CID | 23518399 |
| Molecular Formula | C20H20Cl2N2 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (10S,14S)-7-(2,3-dichlorophenyl)-1,12-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5(16),6,8-triene |
| SMILES | Clc1cccc(-c2cc3c4c(c2)[C@H]2CNC[C@H]2CN4CCC3)c1Cl |
| InChI | InChI=1S/C20H20Cl2N2/c21-18-5-1-4-15(19(18)22)13-7-12-3-2-6-24-11-14-9-23-10-17(14)16(8-13)20(12)24/h1,4-5,7-8,14,17,23H,2-3,6,9-11H2/t14-,17-/m0/s1 |
| InChIKey | BNHNKQUZMHQJOX-YOEHRIQHSA-N |
| XLogP | 4.73 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |