C19H19Cl2N3 — CID 68523009
(2S,6S)-N-(2,4-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine (PubChem CID 68523009) has the molecular formula C19H19Cl2N3 and a molecular weight of 360.29 g/mol. Its IUPAC name is (2S,6S)-N-(2,4-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine.
| Compound Name | (2S,6S)-N-(2,4-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine |
|---|---|
| PubChem CID | 68523009 |
| Molecular Formula | C19H19Cl2N3 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (2S,6S)-N-(2,4-dichlorophenyl)-4,8-diazatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),11(15),12-trien-13-amine |
| SMILES | Clc1ccc(Nc2cc3c4c(c2)[C@H]2CNC[C@H]2CN4CC3)c(Cl)c1 |
| InChI | InChI=1S/C19H19Cl2N3/c20-13-1-2-18(17(21)6-13)23-14-5-11-3-4-24-10-12-8-22-9-16(12)15(7-14)19(11)24/h1-2,5-7,12,16,22-23H,3-4,8-10H2/t12-,16-/m0/s1 |
| InChIKey | OZJIOZNTDODJBY-LRDDRELGSA-N |
| XLogP | 4.42 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|