C15H16Cl2N4 — CID 141432836
1-[5-(2,3-dichlorophenyl)pyrimidin-2-yl]-1,4-diazepane (PubChem CID 141432836) has the molecular formula C15H16Cl2N4 and a molecular weight of 323.23 g/mol. Its IUPAC name is 1-[5-(2,3-dichlorophenyl)pyrimidin-2-yl]-1,4-diazepane.
| Compound Name | 1-[5-(2,3-dichlorophenyl)pyrimidin-2-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 141432836 |
| Molecular Formula | C15H16Cl2N4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-[5-(2,3-dichlorophenyl)pyrimidin-2-yl]-1,4-diazepane |
| SMILES | Clc1cccc(-c2cnc(N3CCCNCC3)nc2)c1Cl |
| InChI | InChI=1S/C15H16Cl2N4/c16-13-4-1-3-12(14(13)17)11-9-19-15(20-10-11)21-7-2-5-18-6-8-21/h1,3-4,9-10,18H,2,5-8H2 |
| InChIKey | WXHBFTJQVUINJG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |