C16H18Cl2N4O — CID 175982328
1-[5-[(2,6-dichlorophenyl)methoxy]pyrimidin-2-yl]-1,4-diazepane (PubChem CID 175982328) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is 1-[5-[(2,6-dichlorophenyl)methoxy]pyrimidin-2-yl]-1,4-diazepane.
| Compound Name | 1-[5-[(2,6-dichlorophenyl)methoxy]pyrimidin-2-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 175982328 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 1-[5-[(2,6-dichlorophenyl)methoxy]pyrimidin-2-yl]-1,4-diazepane |
| SMILES | Clc1cccc(Cl)c1COc1cnc(N2CCCNCC2)nc1 |
| InChI | InChI=1S/C16H18Cl2N4O/c17-14-3-1-4-15(18)13(14)11-23-12-9-20-16(21-10-12)22-7-2-5-19-6-8-22/h1,3-4,9-10,19H,2,5-8,11H2 |
| InChIKey | GMNNTDLLAPCZPM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |