C16H20N4O — CID 117224594
1-[5-(3-methylphenoxy)pyrimidin-2-yl]-1,4-diazepane (PubChem CID 117224594) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[5-(3-methylphenoxy)pyrimidin-2-yl]-1,4-diazepane.
| Compound Name | 1-[5-(3-methylphenoxy)pyrimidin-2-yl]-1,4-diazepane |
|---|---|
| PubChem CID | 117224594 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-[5-(3-methylphenoxy)pyrimidin-2-yl]-1,4-diazepane |
| SMILES | Cc1cccc(Oc2cnc(N3CCCNCC3)nc2)c1 |
| InChI | InChI=1S/C16H20N4O/c1-13-4-2-5-14(10-13)21-15-11-18-16(19-12-15)20-8-3-6-17-7-9-20/h2,4-5,10-12,17H,3,6-9H2,1H3 |
| InChIKey | IFOFVGPKVHIZML-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |