C16H20N4O — CID 117224249
2-[[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]methyl]phenol (PubChem CID 117224249) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]methyl]phenol.
| Compound Name | 2-[[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]methyl]phenol |
|---|---|
| PubChem CID | 117224249 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 2-[[2-(1,4-diazepan-1-yl)pyrimidin-5-yl]methyl]phenol |
| SMILES | Oc1ccccc1Cc1cnc(N2CCCNCC2)nc1 |
| InChI | InChI=1S/C16H20N4O/c21-15-5-2-1-4-14(15)10-13-11-18-16(19-12-13)20-8-3-6-17-7-9-20/h1-2,4-5,11-12,17,21H,3,6-10H2 |
| InChIKey | BPBWCVTWTJZGHP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |