C15H20N4O — CID 13112734
4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-diethylphenol (PubChem CID 13112734) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-diethylphenol.
| Compound Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-diethylphenol |
|---|---|
| PubChem CID | 13112734 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[(2,4-diaminopyrimidin-5-yl)methyl]-2,6-diethylphenol |
| SMILES | CCc1cc(Cc2cnc(N)nc2N)cc(CC)c1O |
| InChI | InChI=1S/C15H20N4O/c1-3-10-5-9(6-11(4-2)13(10)20)7-12-8-18-15(17)19-14(12)16/h5-6,8,20H,3-4,7H2,1-2H3,(H4,16,17,18,19) |
| InChIKey | VUYZAOCZFHLOER-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |