C13H17N3 — CID 22036799
1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 22036799) has the molecular formula C13H17N3 and a molecular weight of 215.30 g/mol. Its IUPAC name is 1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | 1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 22036799 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | c1cc2c3c(c1)C1CNCCC1N3CCN2 |
| InChI | InChI=1S/C13H17N3/c1-2-9-10-8-14-5-4-12(10)16-7-6-15-11(3-1)13(9)16/h1-3,10,12,14-15H,4-8H2 |
| InChIKey | LEDSAIXFIJNHLZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |