C22H29N3 — CID 177184384
12-(4,5-dimethylidenehept-6-enyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 177184384) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is 12-(4,5-dimethylidenehept-6-enyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | 12-(4,5-dimethylidenehept-6-enyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 177184384 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 12-(4,5-dimethylidenehept-6-enyl)-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | C=CC(=C)C(=C)CCCN1CCC2C(C1)c1cccc3c1N2CCN3 |
| InChI | InChI=1S/C22H29N3/c1-4-16(2)17(3)7-6-12-24-13-10-21-19(15-24)18-8-5-9-20-22(18)25(21)14-11-23-20/h4-5,8-9,19,21,23H,1-3,6-7,10-15H2 |
| InChIKey | YSIVNTVBRDWPEI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|