C28H41N3O — CID 177208142
4-methyl-12-[(4Z,6Z)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]octa-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 177208142) has the molecular formula C28H41N3O and a molecular weight of 435.66 g/mol. Its IUPAC name is 4-methyl-12-[(4Z,6Z)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]octa-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | 4-methyl-12-[(4Z,6Z)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]octa-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 177208142 |
| Molecular Formula | C28H41N3O |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.32 |
| IUPAC Name | 4-methyl-12-[(4Z,6Z)-4-[1-[(2-methylpropan-2-yl)oxy]ethenyl]octa-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | C=C(OC(C)(C)C)/C(=C\C=C/C)CCCN1CCC2C(C1)c1cccc3c1N2CCN3C |
| InChI | InChI=1S/C28H41N3O/c1-7-8-11-22(21(2)32-28(3,4)5)12-10-16-30-17-15-25-24(20-30)23-13-9-14-26-27(23)31(25)19-18-29(26)6/h7-9,11,13-14,24-25H,2,10,12,15-20H2,1,3-6H3/b8-7-,22-11- |
| InChIKey | UEIVRNKXZSAHRS-MPSUDAJMSA-N |
| XLogP | 5.73 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|