C23H32F2N4O — CID 90655116
1-(4,4-difluoropiperidin-1-yl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one (PubChem CID 90655116) has the molecular formula C23H32F2N4O and a molecular weight of 418.53 g/mol. Its IUPAC name is 1-(4,4-difluoropiperidin-1-yl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one.
| Compound Name | 1-(4,4-difluoropiperidin-1-yl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one |
|---|---|
| PubChem CID | 90655116 |
| Molecular Formula | C23H32F2N4O |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-(4,4-difluoropiperidin-1-yl)-4-[(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-trien-12-yl]butan-1-one |
| SMILES | CN1CCN2c3c(cccc31)[C@@H]1CN(CCCC(=O)N3CCC(F)(F)CC3)CC[C@@H]12 |
| InChI | InChI=1S/C23H32F2N4O/c1-26-14-15-29-19-7-11-27(16-18(19)17-4-2-5-20(26)22(17)29)10-3-6-21(30)28-12-8-23(24,25)9-13-28/h2,4-5,18-19H,3,6-16H2,1H3/t18-,19-/m0/s1 |
| InChIKey | YNYJUMPPJZXNLG-OALUTQOASA-N |
| XLogP | 3.15 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |