C22H31N3S — CID 177208268
4-methyl-12-[(4Z)-4-methylsulfanylhepta-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 177208268) has the molecular formula C22H31N3S and a molecular weight of 369.58 g/mol. Its IUPAC name is 4-methyl-12-[(4Z)-4-methylsulfanylhepta-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | 4-methyl-12-[(4Z)-4-methylsulfanylhepta-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 177208268 |
| Molecular Formula | C22H31N3S |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 4-methyl-12-[(4Z)-4-methylsulfanylhepta-4,6-dienyl]-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | C=C/C=C(/CCCN1CCC2C(C1)c1cccc3c1N2CCN3C)SC |
| InChI | InChI=1S/C22H31N3S/c1-4-7-17(26-3)8-6-12-24-13-11-20-19(16-24)18-9-5-10-21-22(18)25(20)15-14-23(21)2/h4-5,7,9-10,19-20H,1,6,8,11-16H2,2-3H3/b17-7- |
| InChIKey | FTIXFYFOSYPKAO-IDUWFGFVSA-N |
| XLogP | 4.33 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|