C26H30Cl2N2O2S — CID 21302785
tert-butyl (11S,17S)-3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.7.1.05,18.011,17]octadeca-1(18),2,4-triene-14-carboxylate (PubChem CID 21302785) has the molecular formula C26H30Cl2N2O2S and a molecular weight of 505.51 g/mol. Its IUPAC name is tert-butyl (11S,17S)-3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.7.1.05,18.011,17]octadeca-1(18),2,4-triene-14-carboxylate.
| Compound Name | tert-butyl (11S,17S)-3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.7.1.05,18.011,17]octadeca-1(18),2,4-triene-14-carboxylate |
|---|---|
| PubChem CID | 21302785 |
| Molecular Formula | C26H30Cl2N2O2S |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | tert-butyl (11S,17S)-3-(2,4-dichlorophenyl)-6-thia-10,14-diazatetracyclo[8.7.1.05,18.011,17]octadeca-1(18),2,4-triene-14-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2c3cc(-c4ccc(Cl)cc4Cl)cc4c3N(CCCS4)[C@H]2CC1 |
| InChI | InChI=1S/C26H30Cl2N2O2S/c1-26(2,3)32-25(31)29-10-7-19-20-13-16(18-6-5-17(27)15-21(18)28)14-23-24(20)30(9-4-12-33-23)22(19)8-11-29/h5-6,13-15,19,22H,4,7-12H2,1-3H3/t19-,22-/m0/s1 |
| InChIKey | KLPOZMOJVXTAMH-UGKGYDQZSA-N |
| XLogP | 7.46 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |