C21H21Cl2N3O2 — CID 69472910
(11S,16R)-3-(2,4-dichlorophenyl)-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylic acid (PubChem CID 69472910) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is (11S,16R)-3-(2,4-dichlorophenyl)-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylic acid.
| Compound Name | (11S,16R)-3-(2,4-dichlorophenyl)-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylic acid |
|---|---|
| PubChem CID | 69472910 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | (11S,16R)-3-(2,4-dichlorophenyl)-6,10,14-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylic acid |
| SMILES | O=C(O)N1CC[C@H]2[C@@H](C1)c1cc(-c3ccc(Cl)cc3Cl)cc3c1N2CCCN3 |
| InChI | InChI=1S/C21H21Cl2N3O2/c22-13-2-3-14(17(23)10-13)12-8-15-16-11-25(21(27)28)7-4-19(16)26-6-1-5-24-18(9-12)20(15)26/h2-3,8-10,16,19,24H,1,4-7,11H2,(H,27,28)/t16-,19-/m0/s1 |
| InChIKey | NMKOGRXZSDMMND-LPHOPBHVSA-N |
| XLogP | 5.13 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |