C24H28N2O3 — CID 20576967
(2S,7R)-13-(2-methoxy-5-propan-2-ylphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid (PubChem CID 20576967) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2S,7R)-13-(2-methoxy-5-propan-2-ylphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid.
| Compound Name | (2S,7R)-13-(2-methoxy-5-propan-2-ylphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid |
|---|---|
| PubChem CID | 20576967 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2S,7R)-13-(2-methoxy-5-propan-2-ylphenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-triene-4-carboxylic acid |
| SMILES | COc1ccc(C(C)C)cc1-c1cc2c3c(c1)[C@H]1CN(C(=O)O)CC[C@H]1N3CC2 |
| InChI | InChI=1S/C24H28N2O3/c1-14(2)15-4-5-22(29-3)18(11-15)17-10-16-6-9-26-21-7-8-25(24(27)28)13-20(21)19(12-17)23(16)26/h4-5,10-12,14,20-21H,6-9,13H2,1-3H3,(H,27,28)/t20-,21-/m1/s1 |
| InChIKey | KRLXILJXJMIVEC-NHCUHLMSSA-N |
| XLogP | 4.70 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |