C25H36N2O2S — CID 21302760
tert-butyl (11S,16R)-3-cyclohexyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate (PubChem CID 21302760) has the molecular formula C25H36N2O2S and a molecular weight of 428.64 g/mol. Its IUPAC name is tert-butyl (11S,16R)-3-cyclohexyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate.
| Compound Name | tert-butyl (11S,16R)-3-cyclohexyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate |
|---|---|
| PubChem CID | 21302760 |
| Molecular Formula | C25H36N2O2S |
| Molecular Weight | 428.64 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | tert-butyl (11S,16R)-3-cyclohexyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2[C@@H](C1)c1cc(C3CCCCC3)cc3c1N2CCCS3 |
| InChI | InChI=1S/C25H36N2O2S/c1-25(2,3)29-24(28)26-12-10-21-20(16-26)19-14-18(17-8-5-4-6-9-17)15-22-23(19)27(21)11-7-13-30-22/h14-15,17,20-21H,4-13,16H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | SSARONRLMARVQP-SFTDATJTSA-N |
| XLogP | 6.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |