C20H28N2O3S — CID 21302780
tert-butyl (11S,16R)-4-methoxy-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate (PubChem CID 21302780) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is tert-butyl (11S,16R)-4-methoxy-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate.
| Compound Name | tert-butyl (11S,16R)-4-methoxy-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate |
|---|---|
| PubChem CID | 21302780 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | tert-butyl (11S,16R)-4-methoxy-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),2,4-triene-14-carboxylate |
| SMILES | COc1ccc2c3c1SCCCN3[C@H]1CCN(C(=O)OC(C)(C)C)C[C@@H]21 |
| InChI | InChI=1S/C20H28N2O3S/c1-20(2,3)25-19(23)21-10-8-15-14(12-21)13-6-7-16(24-4)18-17(13)22(15)9-5-11-26-18/h6-7,14-15H,5,8-12H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | LDJAYORVIKGDIL-GJZGRUSLSA-N |
| XLogP | 4.10 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |