C28H36N2O3S — CID 22735690
tert-butyl 3-(4-methoxy-2-methylphenyl)-2-methyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate (PubChem CID 22735690) has the molecular formula C28H36N2O3S and a molecular weight of 480.67 g/mol. Its IUPAC name is tert-butyl 3-(4-methoxy-2-methylphenyl)-2-methyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate.
| Compound Name | tert-butyl 3-(4-methoxy-2-methylphenyl)-2-methyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
|---|---|
| PubChem CID | 22735690 |
| Molecular Formula | C28H36N2O3S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | tert-butyl 3-(4-methoxy-2-methylphenyl)-2-methyl-6-thia-10,14-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1,3,5(17)-triene-14-carboxylate |
| SMILES | COc1ccc(-c2cc3c4c(c2C)C2CN(C(=O)OC(C)(C)C)CCC2N4CCCS3)c(C)c1 |
| InChI | InChI=1S/C28H36N2O3S/c1-17-14-19(32-6)8-9-20(17)21-15-24-26-25(18(21)2)22-16-29(27(31)33-28(3,4)5)12-10-23(22)30(26)11-7-13-34-24/h8-9,14-15,22-23H,7,10-13,16H2,1-6H3 |
| InChIKey | RYMLYRQWYLPQOQ-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |