C25H24Cl2N2O2S — CID 66821476
(3aR,10bS)-2-benzyl-5-(2,3-dichlorophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine (PubChem CID 66821476) has the molecular formula C25H24Cl2N2O2S and a molecular weight of 487.45 g/mol. Its IUPAC name is (3aR,10bS)-2-benzyl-5-(2,3-dichlorophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine.
| Compound Name | (3aR,10bS)-2-benzyl-5-(2,3-dichlorophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine |
|---|---|
| PubChem CID | 66821476 |
| Molecular Formula | C25H24Cl2N2O2S |
| Molecular Weight | 487.45 g/mol |
| Exact Mass | 486.09 |
| IUPAC Name | (3aR,10bS)-2-benzyl-5-(2,3-dichlorophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N1Cc2ccccc2[C@H]2CN(Cc3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C25H24Cl2N2O2S/c26-23-11-6-12-24(25(23)27)32(30,31)29-15-19-9-4-5-10-21(19)22-17-28(14-20(22)16-29)13-18-7-2-1-3-8-18/h1-12,20,22H,13-17H2/t20-,22+/m1/s1 |
| InChIKey | XRSICEMDMCSRRR-IRLDBZIGSA-N |
| XLogP | 5.41 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |