C19H20N2O — CID 66821521
(3aS,10bS)-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 66821521) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (3aS,10bS)-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aS,10bS)-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 66821521 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (3aS,10bS)-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | O=C1NC[C@H]2CN(Cc3ccccc3)C[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C19H20N2O/c22-19-17-9-5-4-8-16(17)18-13-21(12-15(18)10-20-19)11-14-6-2-1-3-7-14/h1-9,15,18H,10-13H2,(H,20,22)/t15-,18-/m0/s1 |
| InChIKey | VSMLRPALNPMKHI-YJBOKZPZSA-N |
| XLogP | 2.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |