C21H22N2O3 — CID 54673688
methyl (3aR,10bR)-2-benzyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxylate (PubChem CID 54673688) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is methyl (3aR,10bR)-2-benzyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxylate.
| Compound Name | methyl (3aR,10bR)-2-benzyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 54673688 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl (3aR,10bR)-2-benzyl-6-oxo-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepine-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)NC[C@@H]1CN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C21H22N2O3/c1-26-21(25)15-7-8-17-18(9-15)20(24)22-10-16-12-23(13-19(16)17)11-14-5-3-2-4-6-14/h2-9,16,19H,10-13H2,1H3,(H,22,24)/t16-,19-/m1/s1 |
| InChIKey | CHXVJUOONGIDSU-VQIMIIECSA-N |
| XLogP | 2.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |