C20H19ClN2O2 — CID 66818981
methyl 2-(1-benzyl-4-cyanopyrrolidin-3-yl)-5-chlorobenzoate (PubChem CID 66818981) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is methyl 2-(1-benzyl-4-cyanopyrrolidin-3-yl)-5-chlorobenzoate.
| Compound Name | methyl 2-(1-benzyl-4-cyanopyrrolidin-3-yl)-5-chlorobenzoate |
|---|---|
| PubChem CID | 66818981 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | methyl 2-(1-benzyl-4-cyanopyrrolidin-3-yl)-5-chlorobenzoate |
| SMILES | COC(=O)c1cc(Cl)ccc1C1CN(Cc2ccccc2)CC1C#N |
| InChI | InChI=1S/C20H19ClN2O2/c1-25-20(24)18-9-16(21)7-8-17(18)19-13-23(12-15(19)10-22)11-14-5-3-2-4-6-14/h2-9,15,19H,11-13H2,1H3 |
| InChIKey | KKQWZCVFXBIXHM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |