C20H19FN2O2 — CID 66819057
methyl 2-[(3S,4S)-1-benzyl-4-cyanopyrrolidin-3-yl]-6-fluorobenzoate (PubChem CID 66819057) has the molecular formula C20H19FN2O2 and a molecular weight of 338.38 g/mol. Its IUPAC name is methyl 2-[(3S,4S)-1-benzyl-4-cyanopyrrolidin-3-yl]-6-fluorobenzoate.
| Compound Name | methyl 2-[(3S,4S)-1-benzyl-4-cyanopyrrolidin-3-yl]-6-fluorobenzoate |
|---|---|
| PubChem CID | 66819057 |
| Molecular Formula | C20H19FN2O2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | methyl 2-[(3S,4S)-1-benzyl-4-cyanopyrrolidin-3-yl]-6-fluorobenzoate |
| SMILES | COC(=O)c1c(F)cccc1[C@H]1CN(Cc2ccccc2)C[C@H]1C#N |
| InChI | InChI=1S/C20H19FN2O2/c1-25-20(24)19-16(8-5-9-18(19)21)17-13-23(12-15(17)10-22)11-14-6-3-2-4-7-14/h2-9,15,17H,11-13H2,1H3/t15-,17+/m1/s1 |
| InChIKey | PVTOJELYAAALGN-WBVHZDCISA-N |
| XLogP | 3.35 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |