C19H21N3O — CID 67470782
(3aS)-8-amino-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one (PubChem CID 67470782) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (3aS)-8-amino-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one.
| Compound Name | (3aS)-8-amino-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
|---|---|
| PubChem CID | 67470782 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (3aS)-8-amino-2-benzyl-1,3,3a,4,5,10b-hexahydropyrrolo[3,4-d][2]benzazepin-6-one |
| SMILES | Nc1ccc2c(c1)C(=O)NC[C@H]1CN(Cc3ccccc3)CC21 |
| InChI | InChI=1S/C19H21N3O/c20-15-6-7-16-17(8-15)19(23)21-9-14-11-22(12-18(14)16)10-13-4-2-1-3-5-13/h1-8,14,18H,9-12,20H2,(H,21,23)/t14-,18?/m0/s1 |
| InChIKey | KZSCZMJHDZCBDD-PIVQAISJSA-N |
| XLogP | 2.23 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|