C25H25BrN2O2S — CID 54672827
(3aS,10bR)-2-benzyl-5-(2-bromophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine (PubChem CID 54672827) has the molecular formula C25H25BrN2O2S and a molecular weight of 497.46 g/mol. Its IUPAC name is (3aS,10bR)-2-benzyl-5-(2-bromophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine.
| Compound Name | (3aS,10bR)-2-benzyl-5-(2-bromophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine |
|---|---|
| PubChem CID | 54672827 |
| Molecular Formula | C25H25BrN2O2S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | (3aS,10bR)-2-benzyl-5-(2-bromophenyl)sulfonyl-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine |
| SMILES | O=S(=O)(c1ccccc1Br)N1Cc2ccccc2[C@@H]2CN(Cc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C25H25BrN2O2S/c26-24-12-6-7-13-25(24)31(29,30)28-16-20-10-4-5-11-22(20)23-18-27(15-21(23)17-28)14-19-8-2-1-3-9-19/h1-13,21,23H,14-18H2/t21-,23+/m0/s1 |
| InChIKey | YGACHEZKFDQFJZ-JTHBVZDNSA-N |
| XLogP | 4.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |