C18H18IN — CID 3299296
10-iodo-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene (PubChem CID 3299296) has the molecular formula C18H18IN and a molecular weight of 375.25 g/mol. Its IUPAC name is 10-iodo-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene.
| Compound Name | 10-iodo-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
|---|---|
| PubChem CID | 3299296 |
| Molecular Formula | C18H18IN |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 10-iodo-1-azapentacyclo[10.6.1.03,7.08,19.013,17]nonadeca-5,8,10,12(19),14-pentaene |
| SMILES | Ic1cc2c3c(c1)C1C=CCC1CN3CC1CC=CC21 |
| InChI | InChI=1S/C18H18IN/c19-13-7-16-14-5-1-3-11(14)9-20-10-12-4-2-6-15(12)17(8-13)18(16)20/h1-2,5-8,11-12,14-15H,3-4,9-10H2 |
| InChIKey | ZMAYSCPWRLHCTG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|