C15H19N — CID 163795212
tricyclo[9.4.0.03,8]pentadeca-1(15),4,11,13-tetraen-2-amine (PubChem CID 163795212) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is tricyclo[9.4.0.03,8]pentadeca-1(15),4,11,13-tetraen-2-amine.
| Compound Name | tricyclo[9.4.0.03,8]pentadeca-1(15),4,11,13-tetraen-2-amine |
|---|---|
| PubChem CID | 163795212 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | tricyclo[9.4.0.03,8]pentadeca-1(15),4,11,13-tetraen-2-amine |
| SMILES | NC1c2ccccc2CCC2CCC=CC21 |
| InChI | InChI=1S/C15H19N/c16-15-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)15/h1,3-5,7-8,12,14-15H,2,6,9-10,16H2 |
| InChIKey | NAEGWYBDRHWRSO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|