C20H20 — CID 91351407
1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,4-dihydronaphthalene (PubChem CID 91351407) has the molecular formula C20H20 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,4-dihydronaphthalene.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,4-dihydronaphthalene |
|---|---|
| PubChem CID | 91351407 |
| Molecular Formula | C20H20 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,4-dihydronaphthalene |
| SMILES | C1=CC(C2CCc3ccccc3C2)c2ccccc2C1 |
| InChI | InChI=1S/C20H20/c1-2-8-17-14-18(13-12-15(17)6-1)20-11-5-9-16-7-3-4-10-19(16)20/h1-8,10-11,18,20H,9,12-14H2 |
| InChIKey | ZIKJKKSKWUOEDP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|