C12H13NO3S — CID 170458147
2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)sulfamic acid (PubChem CID 170458147) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)sulfamic acid.
| Compound Name | 2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)sulfamic acid |
|---|---|
| PubChem CID | 170458147 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)sulfamic acid |
| SMILES | C#CCN(C1CCc2ccccc21)S(=O)(=O)O |
| InChI | InChI=1S/C12H13NO3S/c1-2-9-13(17(14,15)16)12-8-7-10-5-3-4-6-11(10)12/h1,3-6,12H,7-9H2,(H,14,15,16) |
| InChIKey | BCYJFVFKTDBUOD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|