C16H19NO2 — CID 46189995
propan-2-yl N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylcarbamate (PubChem CID 46189995) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is propan-2-yl N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylcarbamate.
| Compound Name | propan-2-yl N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylcarbamate |
|---|---|
| PubChem CID | 46189995 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | propan-2-yl N-[(1R)-2,3-dihydro-1H-inden-1-yl]-N-prop-2-ynylcarbamate |
| SMILES | C#CCN(C(=O)OC(C)C)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C16H19NO2/c1-4-11-17(16(18)19-12(2)3)15-10-9-13-7-5-6-8-14(13)15/h1,5-8,12,15H,9-11H2,2-3H3/t15-/m1/s1 |
| InChIKey | MKJOVHDCAZTONX-OAHLLOKOSA-N |
| XLogP | 3.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|