C18H23N5 — CID 163877068
N'-[[[amino-[[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]methylidene]amino]methyl]-2-methylprop-2-enimidamide (PubChem CID 163877068) has the molecular formula C18H23N5 and a molecular weight of 309.42 g/mol. Its IUPAC name is N'-[[[amino-[[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]methylidene]amino]methyl]-2-methylprop-2-enimidamide.
| Compound Name | N'-[[[amino-[[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]methylidene]amino]methyl]-2-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 163877068 |
| Molecular Formula | C18H23N5 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | N'-[[[amino-[[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]methylidene]amino]methyl]-2-methylprop-2-enimidamide |
| SMILES | C#CCN(C(N)=NCN=C(N)C(=C)C)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C18H23N5/c1-4-11-23(18(20)22-12-21-17(19)13(2)3)16-10-9-14-7-5-6-8-15(14)16/h1,5-8,16H,2,9-12H2,3H3,(H2,19,21)(H2,20,22)/t16-/m1/s1 |
| InChIKey | PPUUHTFRGKIVKU-MRXNPFEDSA-N |
| XLogP | 1.81 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|