C22H29NO4 — CID 146510375
[[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylcarbamoyl]oxymethyl 2,2,4-trimethylpentanoate (PubChem CID 146510375) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is [[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylcarbamoyl]oxymethyl 2,2,4-trimethylpentanoate.
| Compound Name | [[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylcarbamoyl]oxymethyl 2,2,4-trimethylpentanoate |
|---|---|
| PubChem CID | 146510375 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [[(1R)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylcarbamoyl]oxymethyl 2,2,4-trimethylpentanoate |
| SMILES | C#CCN(C(=O)OCOC(=O)C(C)(C)CC(C)C)[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C22H29NO4/c1-6-13-23(19-12-11-17-9-7-8-10-18(17)19)21(25)27-15-26-20(24)22(4,5)14-16(2)3/h1,7-10,16,19H,11-15H2,2-5H3/t19-/m1/s1 |
| InChIKey | XMXCAWMMKMFEMK-LJQANCHMSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|