C16H18NO3S- — CID 175678918
N,N-bis(prop-2-ynyl)-2,3-dihydro-1H-inden-1-amine;methanesulfonate (PubChem CID 175678918) has the molecular formula C16H18NO3S- and a molecular weight of 304.39 g/mol. Its IUPAC name is N,N-bis(prop-2-ynyl)-2,3-dihydro-1H-inden-1-amine;methanesulfonate.
| Compound Name | N,N-bis(prop-2-ynyl)-2,3-dihydro-1H-inden-1-amine;methanesulfonate |
|---|---|
| PubChem CID | 175678918 |
| Molecular Formula | C16H18NO3S- |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N,N-bis(prop-2-ynyl)-2,3-dihydro-1H-inden-1-amine;methanesulfonate |
| SMILES | C#CCN(CC#C)C1CCc2ccccc21.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C15H15N.CH4O3S/c1-3-11-16(12-4-2)15-10-9-13-7-5-6-8-14(13)15;1-5(2,3)4/h1-2,5-8,15H,9-12H2;1H3,(H,2,3,4)/p-1 |
| InChIKey | DPLDIZTWVRTCGZ-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|