C21H28N2O — CID 55841446
N-(cyclohexylmethyl)-2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]acetamide (PubChem CID 55841446) has the molecular formula C21H28N2O and a molecular weight of 324.47 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]acetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]acetamide |
|---|---|
| PubChem CID | 55841446 |
| Molecular Formula | C21H28N2O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.22 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[2,3-dihydro-1H-inden-1-yl(prop-2-ynyl)amino]acetamide |
| SMILES | C#CCN(CC(=O)NCC1CCCCC1)C1CCc2ccccc21 |
| InChI | InChI=1S/C21H28N2O/c1-2-14-23(20-13-12-18-10-6-7-11-19(18)20)16-21(24)22-15-17-8-4-3-5-9-17/h1,6-7,10-11,17,20H,3-5,8-9,12-16H2,(H,22,24) |
| InChIKey | XSGMESDIDFRJBB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|