C15H18FN — CID 53472248
N-(2-fluoroethyl)-N-prop-2-ynyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 53472248) has the molecular formula C15H18FN and a molecular weight of 231.31 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N-prop-2-ynyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-(2-fluoroethyl)-N-prop-2-ynyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 53472248 |
| Molecular Formula | C15H18FN |
| Molecular Weight | 231.31 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-(2-fluoroethyl)-N-prop-2-ynyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | C#CCN(CCF)C1CCCc2ccccc21 |
| InChI | InChI=1S/C15H18FN/c1-2-11-17(12-10-16)15-9-5-7-13-6-3-4-8-14(13)15/h1,3-4,6,8,15H,5,7,9-12H2 |
| InChIKey | WWWUWYUKAIYNQZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|