C18H21N3O — CID 94588890
N-(2-cyanoethyl)-2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]-N-methylacetamide (PubChem CID 94588890) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]-N-methylacetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 94588890 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[(1S)-2,3-dihydro-1H-inden-1-yl]-prop-2-ynylamino]-N-methylacetamide |
| SMILES | C#CCN(CC(=O)N(C)CCC#N)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C18H21N3O/c1-3-12-21(14-18(22)20(2)13-6-11-19)17-10-9-15-7-4-5-8-16(15)17/h1,4-5,7-8,17H,6,9-10,12-14H2,2H3/t17-/m0/s1 |
| InChIKey | ONCRBCDTLGMSBO-KRWDZBQOSA-N |
| XLogP | 1.98 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|