C18H17BrCl2 — CID 63470691
5-bromo-6-[(3,4-dichlorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 63470691) has the molecular formula C18H17BrCl2 and a molecular weight of 384.14 g/mol. Its IUPAC name is 5-bromo-6-[(3,4-dichlorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 5-bromo-6-[(3,4-dichlorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 63470691 |
| Molecular Formula | C18H17BrCl2 |
| Molecular Weight | 384.14 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 5-bromo-6-[(3,4-dichlorophenyl)methyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | Clc1ccc(CC2CCCc3ccccc3C2Br)cc1Cl |
| InChI | InChI=1S/C18H17BrCl2/c19-18-14(10-12-8-9-16(20)17(21)11-12)6-3-5-13-4-1-2-7-15(13)18/h1-2,4,7-9,11,14,18H,3,5-6,10H2 |
| InChIKey | KRPZARALMFCYIN-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.14 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|